the sky is blue because of reflection of blue light of sea and ocean.
the moon appear in the daytime because light of sun is brighter than of moon
airplanes stay in the air by maintaining balance in air and gravity.
birds did not get electrocuted when they land on an electric wire because there body is non conductor.
[tex]Why is the sky blue? Why does the moon appear in the daytime?How much does the sky weigh?How do ai[/tex] [tex]Why is the sky blue? Why does the moon appear in the daytime?How much does the sky weigh?How do ai[/tex]
Qualitative is to observe and note a quality about something - like the paper airplanes are made out of "white" paper. White is a qualitative property.
Quantitative is to observe and measure a value - like the time of flight of a paper airplane.
A plane's engines are designed to move it forward at high speed. That makes air flow rapidly over the wings, which throw the air down toward the ground, generating an upward force called lift that overcomes the plane's weight and holds it in the sky. The wings force the air downward and that pushes the plane upward.
1. Gases and particles in Earth's atmosphere scatter sunlight in all directions. Blue light is scattered more than other colors because it travels as shorter, smaller waves. This is why we see a blue sky most of the time.
2. The surface of the moon is reflecting the sun's light into our eyes. When we see the moon during the day it's because the moon is in the right spot in the sky and it's reflecting enough light to be as bright, or brighter, than the sky.
Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o
the sky is blue because of reflection of blue light of sea and ocean.
the moon appear in the daytime because light of sun is brighter than of moon
airplanes stay in the air by maintaining balance in air and gravity.
birds did not get electrocuted when they land on an electric wire because there body is non conductor.
[tex]Why is the sky blue? Why does the moon appear in the daytime?How much does the sky weigh?How do ai[/tex]
[tex]Why is the sky blue? Why does the moon appear in the daytime?How much does the sky weigh?How do ai[/tex]
Explanation:
Qualitative is to observe and note a quality about something - like the paper airplanes are made out of "white" paper. White is a qualitative property.
Quantitative is to observe and measure a value - like the time of flight of a paper airplane.
z o o m id :- 257 473 5835 password:- 1234 host waiting for everyone
there is one boy n i gg a
follow= follow
A plane's engines are designed to move it forward at high speed. That makes air flow rapidly over the wings, which throw the air down toward the ground, generating an upward force called lift that overcomes the plane's weight and holds it in the sky. The wings force the air downward and that pushes the plane upward.
Explanation:
1. Because its the reflection off the ocean
2. Because its the moons reflection across the sky
3. Depends on the layer of the sky your talkin about
4. 5.972 × 10^24 kg
5. The wings catch the wind and the thrusters in the back help keep it up.
6. because its H2O and thats just how it is.
7. Because they have hollow legs which helps them not get eletrocuted because it just passes through their legs
Explanation:
this a false
explanation:
1. Gases and particles in Earth's atmosphere scatter sunlight in all directions. Blue light is scattered more than other colors because it travels as shorter, smaller waves. This is why we see a blue sky most of the time.
2. The surface of the moon is reflecting the sun's light into our eyes. When we see the moon during the day it's because the moon is in the right spot in the sky and it's reflecting enough light to be as bright, or brighter, than the sky.
3. 14.7 lbs per square inch
4. 5.972 × 10^24 kg
Explanation:
Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o
i)Sky is Blue Because Of The Atmosphere
ii)Moon Appears In the Day Tike Because Of The Reflection Of Sun light
iii)Sky Weighs 0 Gms
iv)Earth Weighs Alot I dont Remember Exactly
V) Due to The lift Created By the wings (BerniLuous Theorem) And Newtons iii Law
vi)Water Is Wet Bcoz Of Moisture
Vii)Scattering Of Light Makes A Rainbow
viii)Birds Are Superheros
ix)Yes Aliens Exist Somewhere in the Vast Universe
X)Birds Migrate To A Worm Place.
xi)Ocean Is Blue Bcoz Of High Content Of Oxygen And Carbon Dioxide
xii)Bcoz Sun Is S Clos To Us.
Hope It Helps
Mark Me As Brainliest If U Want
Bcoz I wasted So Much Time In This.
God Bless You!
1. D - 3N/m^2
2. C - 2 meters below the surface of a swimming pool
3. B - Cork
4. A - Depends only on the type of fluid
5. A - The air preassure decreases
b-d
Step-by-step explanation:
At the airport, d airplanes flew away, and b were still there.
Number of airplanes which flew away =d Number of airplanes which stayed at the airport =b
We are required to determine how many more airplanes stayed at the airport than flew away.
To do this, we subtract the number of airplanes which flew away from the number which stayed.
Therefore:
Number of more airplanes which stayed than flew away
=Number of airplanes which stayed-Number of airplanes which flew away
= b-d
1: because the sea reflects up to the sky and that's why the sky is blue